C25H21FN4O5S — CID 91574005
N-(1-amino-2-oxopropyl)-3-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]benzenesulfonamide (PubChem CID 91574005) has the molecular formula C25H21FN4O5S and a molecular weight of 508.53 g/mol. Its IUPAC name is N-(1-amino-2-oxopropyl)-3-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]benzenesulfonamide.
| Compound Name | N-(1-amino-2-oxopropyl)-3-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]benzenesulfonamide |
|---|---|
| PubChem CID | 91574005 |
| Molecular Formula | C25H21FN4O5S |
| Molecular Weight | 508.53 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | N-(1-amino-2-oxopropyl)-3-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]benzenesulfonamide |
| SMILES | CC(=O)C(N)NS(=O)(=O)c1cccc(C(=O)C(C(=O)c2cccc(F)c2)c2nc3ccccc3[nH]2)c1 |
| InChI | InChI=1S/C25H21FN4O5S/c1-14(31)24(27)30-36(34,35)18-9-5-7-16(13-18)23(33)21(22(32)15-6-4-8-17(26)12-15)25-28-19-10-2-3-11-20(19)29-25/h2-13,21,24,30H,27H2,1H3,(H,28,29) |
| InChIKey | MJTYKTKMZVHJJE-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 152.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.53 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|