C20H12ClFN2O4S2 — CID 91284993
5-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]thiophene-2-sulfonyl chloride (PubChem CID 91284993) has the molecular formula C20H12ClFN2O4S2 and a molecular weight of 462.91 g/mol. Its IUPAC name is 5-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]thiophene-2-sulfonyl chloride.
| Compound Name | 5-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]thiophene-2-sulfonyl chloride |
|---|---|
| PubChem CID | 91284993 |
| Molecular Formula | C20H12ClFN2O4S2 |
| Molecular Weight | 462.91 g/mol |
| Exact Mass | 461.99 |
| IUPAC Name | 5-[2-(1H-benzimidazol-2-yl)-3-(3-fluorophenyl)-3-oxopropanoyl]thiophene-2-sulfonyl chloride |
| SMILES | O=C(c1cccc(F)c1)C(C(=O)c1ccc(S(=O)(=O)Cl)s1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C20H12ClFN2O4S2/c21-30(27,28)16-9-8-15(29-16)19(26)17(18(25)11-4-3-5-12(22)10-11)20-23-13-6-1-2-7-14(13)24-20/h1-10,17H,(H,23,24) |
| InChIKey | PTZWPFVSNQSPRS-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 96.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.91 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|