C24H18O4 — CID 91574402
4-O-(4-hepta-1,3,5-triynylphenyl) 1-O-(4-methylphenyl) (Z)-but-2-enedioate;molecular hydrogen (PubChem CID 91574402) has the molecular formula C24H18O4 and a molecular weight of 370.40 g/mol. Its IUPAC name is 4-O-(4-hepta-1,3,5-triynylphenyl) 1-O-(4-methylphenyl) (Z)-but-2-enedioate;molecular hydrogen.
| Compound Name | 4-O-(4-hepta-1,3,5-triynylphenyl) 1-O-(4-methylphenyl) (Z)-but-2-enedioate;molecular hydrogen |
|---|---|
| PubChem CID | 91574402 |
| Molecular Formula | C24H18O4 |
| Molecular Weight | 370.40 g/mol |
| Exact Mass | 370.12 |
| IUPAC Name | 4-O-(4-hepta-1,3,5-triynylphenyl) 1-O-(4-methylphenyl) (Z)-but-2-enedioate;molecular hydrogen |
| SMILES | CC#CC#CC#Cc1ccc(OC(=O)/C=C\C(=O)Oc2ccc(C)cc2)cc1.[H][H] |
| InChI | InChI=1S/C24H16O4.H2/c1-3-4-5-6-7-8-20-11-15-22(16-12-20)28-24(26)18-17-23(25)27-21-13-9-19(2)10-14-21;/h9-18H,1-2H3;1H/b18-17-; |
| InChIKey | OCKZKPNZSJFQKN-YBFBCAGJSA-N |
| XLogP | 3.69 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.40 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|