C19H33N3O2S2 — CID 91578636
2-(1H-indol-3-yl)-N,N-dimethylethanamine;N-(5-sulfanylpentyl)ethanesulfonamide (PubChem CID 91578636) has the molecular formula C19H33N3O2S2 and a molecular weight of 399.63 g/mol. Its IUPAC name is 2-(1H-indol-3-yl)-N,N-dimethylethanamine;N-(5-sulfanylpentyl)ethanesulfonamide.
| Compound Name | 2-(1H-indol-3-yl)-N,N-dimethylethanamine;N-(5-sulfanylpentyl)ethanesulfonamide |
|---|---|
| PubChem CID | 91578636 |
| Molecular Formula | C19H33N3O2S2 |
| Molecular Weight | 399.63 g/mol |
| Exact Mass | 399.20 |
| IUPAC Name | 2-(1H-indol-3-yl)-N,N-dimethylethanamine;N-(5-sulfanylpentyl)ethanesulfonamide |
| SMILES | CCS(=O)(=O)NCCCCCS.CN(C)CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C12H16N2.C7H17NO2S2/c1-14(2)8-7-10-9-13-12-6-4-3-5-11(10)12;1-2-12(9,10)8-6-4-3-5-7-11/h3-6,9,13H,7-8H2,1-2H3;8,11H,2-7H2,1H3 |
| InChIKey | ZHEJJAZZPRWVSS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.63 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|