C17H13F3N2O2 — CID 91578683
4-[hydroxy(phenyl)methyl]-2-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-one (PubChem CID 91578683) has the molecular formula C17H13F3N2O2 and a molecular weight of 334.30 g/mol. Its IUPAC name is 4-[hydroxy(phenyl)methyl]-2-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-one.
| Compound Name | 4-[hydroxy(phenyl)methyl]-2-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 91578683 |
| Molecular Formula | C17H13F3N2O2 |
| Molecular Weight | 334.30 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | 4-[hydroxy(phenyl)methyl]-2-phenyl-5-(trifluoromethyl)-1H-pyrazol-3-one |
| SMILES | O=c1c(C(O)c2ccccc2)c(C(F)(F)F)[nH]n1-c1ccccc1 |
| InChI | InChI=1S/C17H13F3N2O2/c18-17(19,20)15-13(14(23)11-7-3-1-4-8-11)16(24)22(21-15)12-9-5-2-6-10-12/h1-10,14,21,23H |
| InChIKey | LKNHADUYKYTKBR-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.30 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |