C13H6F9N3O2 — CID 137332282
4-nitroso-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-1H-pyrazol-3-one (PubChem CID 137332282) has the molecular formula C13H6F9N3O2 and a molecular weight of 407.19 g/mol. Its IUPAC name is 4-nitroso-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-1H-pyrazol-3-one.
| Compound Name | 4-nitroso-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-1H-pyrazol-3-one |
|---|---|
| PubChem CID | 137332282 |
| Molecular Formula | C13H6F9N3O2 |
| Molecular Weight | 407.19 g/mol |
| Exact Mass | 407.03 |
| IUPAC Name | 4-nitroso-5-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)-2-phenyl-1H-pyrazol-3-one |
| SMILES | O=Nc1c(C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)[nH]n(-c2ccccc2)c1=O |
| InChI | InChI=1S/C13H6F9N3O2/c14-10(15,11(16,17)12(18,19)13(20,21)22)8-7(24-27)9(26)25(23-8)6-4-2-1-3-5-6/h1-5,23H |
| InChIKey | OKFXOSCOETWTGO-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 67.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.19 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|