C5H5BrO2S — CID 91578693
4-bromothiane-3,5-dione (PubChem CID 91578693) has the molecular formula C5H5BrO2S and a molecular weight of 209.06 g/mol. Its IUPAC name is 4-bromothiane-3,5-dione.
| Compound Name | 4-bromothiane-3,5-dione |
|---|---|
| PubChem CID | 91578693 |
| Molecular Formula | C5H5BrO2S |
| Molecular Weight | 209.06 g/mol |
| Exact Mass | 207.92 |
| IUPAC Name | 4-bromothiane-3,5-dione |
| SMILES | O=C1CSCC(=O)C1Br |
| InChI | InChI=1S/C5H5BrO2S/c6-5-3(7)1-9-2-4(5)8/h5H,1-2H2 |
| InChIKey | WMIMLRFDDAHOSM-UHFFFAOYSA-N |
| XLogP | 0.63 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.06 |
| LogP ≤ 5 | 0.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|