C27H29N3O3 — CID 91578944
3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-prop-2-ynyl-2H-1,2-oxazole-5-carboxamide (PubChem CID 91578944) has the molecular formula C27H29N3O3 and a molecular weight of 443.55 g/mol. Its IUPAC name is 3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-prop-2-ynyl-2H-1,2-oxazole-5-carboxamide.
| Compound Name | 3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-prop-2-ynyl-2H-1,2-oxazole-5-carboxamide |
|---|---|
| PubChem CID | 91578944 |
| Molecular Formula | C27H29N3O3 |
| Molecular Weight | 443.55 g/mol |
| Exact Mass | 443.22 |
| IUPAC Name | 3-[4-(4-benzylpiperidine-1-carbonyl)phenyl]-5-methyl-N-prop-2-ynyl-2H-1,2-oxazole-5-carboxamide |
| SMILES | C#CCNC(=O)C1(C)C=C(c2ccc(C(=O)N3CCC(Cc4ccccc4)CC3)cc2)NO1 |
| InChI | InChI=1S/C27H29N3O3/c1-3-15-28-26(32)27(2)19-24(29-33-27)22-9-11-23(12-10-22)25(31)30-16-13-21(14-17-30)18-20-7-5-4-6-8-20/h1,4-12,19,21,29H,13-18H2,2H3,(H,28,32) |
| InChIKey | CVPSSDKZITZDMQ-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.55 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|