C25H26ClN3O2 — CID 91583402
4-(4-chlorophenyl)-2-(2-methyl-1H-imidazol-5-yl)-5-[3-(3,4,5-trimethylphenoxy)propyl]-1,3-oxazole (PubChem CID 91583402) has the molecular formula C25H26ClN3O2 and a molecular weight of 435.96 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-(2-methyl-1H-imidazol-5-yl)-5-[3-(3,4,5-trimethylphenoxy)propyl]-1,3-oxazole.
| Compound Name | 4-(4-chlorophenyl)-2-(2-methyl-1H-imidazol-5-yl)-5-[3-(3,4,5-trimethylphenoxy)propyl]-1,3-oxazole |
|---|---|
| PubChem CID | 91583402 |
| Molecular Formula | C25H26ClN3O2 |
| Molecular Weight | 435.96 g/mol |
| Exact Mass | 435.17 |
| IUPAC Name | 4-(4-chlorophenyl)-2-(2-methyl-1H-imidazol-5-yl)-5-[3-(3,4,5-trimethylphenoxy)propyl]-1,3-oxazole |
| SMILES | Cc1ncc(-c2nc(-c3ccc(Cl)cc3)c(CCCOc3cc(C)c(C)c(C)c3)o2)[nH]1 |
| InChI | InChI=1S/C25H26ClN3O2/c1-15-12-21(13-16(2)17(15)3)30-11-5-6-23-24(19-7-9-20(26)10-8-19)29-25(31-23)22-14-27-18(4)28-22/h7-10,12-14H,5-6,11H2,1-4H3,(H,27,28) |
| InChIKey | ATJNYKDWZSGOFS-UHFFFAOYSA-N |
| XLogP | 6.63 |
| TPSA | 63.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.96 |
| LogP ≤ 5 | 6.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|