C21H21ClF3N5O — CID 91584626
1-(6-chloro-2-pyridinyl)-N-[2-(N-ethyl-3-methylanilino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 91584626) has the molecular formula C21H21ClF3N5O and a molecular weight of 451.88 g/mol. Its IUPAC name is 1-(6-chloro-2-pyridinyl)-N-[2-(N-ethyl-3-methylanilino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | 1-(6-chloro-2-pyridinyl)-N-[2-(N-ethyl-3-methylanilino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 91584626 |
| Molecular Formula | C21H21ClF3N5O |
| Molecular Weight | 451.88 g/mol |
| Exact Mass | 451.14 |
| IUPAC Name | 1-(6-chloro-2-pyridinyl)-N-[2-(N-ethyl-3-methylanilino)ethyl]-5-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | CCN(CCNC(=O)c1cnn(-c2cccc(Cl)n2)c1C(F)(F)F)c1cccc(C)c1 |
| InChI | InChI=1S/C21H21ClF3N5O/c1-3-29(15-7-4-6-14(2)12-15)11-10-26-20(31)16-13-27-30(19(16)21(23,24)25)18-9-5-8-17(22)28-18/h4-9,12-13H,3,10-11H2,1-2H3,(H,26,31) |
| InChIKey | UZXQDNNVZGXBMR-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.88 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|