C21H28BrN5O3 — CID 91585033
4-[[5-bromo-4-(cyclohexylamino)pyrimidin-2-yl]amino]-3-methoxy-N-(2-methoxyethyl)benzamide (PubChem CID 91585033) has the molecular formula C21H28BrN5O3 and a molecular weight of 478.39 g/mol. Its IUPAC name is 4-[[5-bromo-4-(cyclohexylamino)pyrimidin-2-yl]amino]-3-methoxy-N-(2-methoxyethyl)benzamide.
| Compound Name | 4-[[5-bromo-4-(cyclohexylamino)pyrimidin-2-yl]amino]-3-methoxy-N-(2-methoxyethyl)benzamide |
|---|---|
| PubChem CID | 91585033 |
| Molecular Formula | C21H28BrN5O3 |
| Molecular Weight | 478.39 g/mol |
| Exact Mass | 477.14 |
| IUPAC Name | 4-[[5-bromo-4-(cyclohexylamino)pyrimidin-2-yl]amino]-3-methoxy-N-(2-methoxyethyl)benzamide |
| SMILES | COCCNC(=O)c1ccc(Nc2ncc(Br)c(NC3CCCCC3)n2)c(OC)c1 |
| InChI | InChI=1S/C21H28BrN5O3/c1-29-11-10-23-20(28)14-8-9-17(18(12-14)30-2)26-21-24-13-16(22)19(27-21)25-15-6-4-3-5-7-15/h8-9,12-13,15H,3-7,10-11H2,1-2H3,(H,23,28)(H2,24,25,26,27) |
| InChIKey | SZBWILJXXNTYGH-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.39 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|