C24H40N2O6S — CID 91587643
tert-butyl (9aS)-7-[[3-(methylsulfonyloxymethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxylate;ethane (PubChem CID 91587643) has the molecular formula C24H40N2O6S and a molecular weight of 484.66 g/mol. Its IUPAC name is tert-butyl (9aS)-7-[[3-(methylsulfonyloxymethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxylate;ethane.
| Compound Name | tert-butyl (9aS)-7-[[3-(methylsulfonyloxymethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxylate;ethane |
|---|---|
| PubChem CID | 91587643 |
| Molecular Formula | C24H40N2O6S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | tert-butyl (9aS)-7-[[3-(methylsulfonyloxymethyl)phenoxy]methyl]-1,3,4,6,7,8,9,9a-octahydropyrido[1,2-a]pyrazine-2-carboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN2CC(COc3cccc(COS(C)(=O)=O)c3)CC[C@H]2C1 |
| InChI | InChI=1S/C22H34N2O6S.C2H6/c1-22(2,3)30-21(25)24-11-10-23-13-18(8-9-19(23)14-24)15-28-20-7-5-6-17(12-20)16-29-31(4,26)27;1-2/h5-7,12,18-19H,8-11,13-16H2,1-4H3;1-2H3/t18?,19-;/m0./s1 |
| InChIKey | GCSOLCNTFNGFML-DSJAQNLYSA-N |
| XLogP | 3.90 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|