About 3,3-dibromododecan-2-one
3,3-dibromododecan-2-one (PubChem CID 91588041) has the molecular formula C12H22Br2O
and a molecular weight of 342.12 g/mol. Its IUPAC name is 3,3-dibromododecan-2-one.
Molecular Properties
| Compound Name | 3,3-dibromododecan-2-one |
| PubChem CID | 91588041 |
| Molecular Formula | C12H22Br2O |
| Molecular Weight | 342.12 g/mol |
| Exact Mass | 340.00 |
| IUPAC Name | 3,3-dibromododecan-2-one |
| SMILES | CCCCCCCCCC(Br)(Br)C(C)=O |
| InChI | InChI=1S/C12H22Br2O/c1-3-4-5-6-7-8-9-10-12(13,14)11(2)15/h3-10H2,1-2H3 |
| InChIKey | NFRVTRRBAKJICQ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 342.12 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dibromododecan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dibromododecan-2-one?
The IUPAC name of 3,3-dibromododecan-2-one (CID 91588041) is 3,3-dibromododecan-2-one.
What is the SMILES notation for 3,3-dibromododecan-2-one?
The canonical SMILES for 3,3-dibromododecan-2-one is CCCCCCCCCC(Br)(Br)C(C)=O.
What is the InChIKey of 3,3-dibromododecan-2-one?
The InChIKey is NFRVTRRBAKJICQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22Br2O/c1-3-4-5-6-7-8-9-10-12(13,14)11(2)15/h3-10H2,1-2H3.
What are the key properties of 3,3-dibromododecan-2-one?
3,3-dibromododecan-2-one has a molecular weight of 342.12 g/mol, XLogP of 5.20, 9 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dibromododecan-2-one is sourced from PubChem (CID 91588041), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).