About CID 150377989
CID 150377989 (PubChem CID 150377989) has the molecular formula C12H14Br2O4
and a molecular weight of 382.05 g/mol.
Molecular Properties
| Compound Name | CID 150377989 |
| PubChem CID | 150377989 |
| Molecular Formula | C12H14Br2O4 |
| Molecular Weight | 382.05 g/mol |
| Exact Mass | 379.93 |
| IUPAC Name | — |
| SMILES | CCCCCCC(Br)(Br)C(=C=O)C(=C=O)C(=O)O |
| InChI | InChI=1S/C12H14Br2O4/c1-2-3-4-5-6-12(13,14)10(8-16)9(7-15)11(17)18/h2-6H2,1H3,(H,17,18) |
| InChIKey | GZCNZDNUNHGFTK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.05 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze CID 150377989 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 150377989?
The IUPAC name of CID 150377989 (CID 150377989) is not available.
What is the SMILES notation for CID 150377989?
The canonical SMILES for CID 150377989 is CCCCCCC(Br)(Br)C(=C=O)C(=C=O)C(=O)O.
What is the InChIKey of CID 150377989?
The InChIKey is GZCNZDNUNHGFTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14Br2O4/c1-2-3-4-5-6-12(13,14)10(8-16)9(7-15)11(17)18/h2-6H2,1H3,(H,17,18).
What are the key properties of CID 150377989?
CID 150377989 has a molecular weight of 382.05 g/mol, XLogP of 3.04, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 150377989 is sourced from PubChem (CID 150377989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).