C29H31F2N3O6 — CID 91590265
2-[6-fluoro-5-[4-[6-fluoro-5-hydroxy-2-methyl-1-[2-(methylamino)ethyl]indol-3-yl]-3-methoxybut-2-enoyl]oxy-1,2-dimethylindol-3-yl]acetic acid (PubChem CID 91590265) has the molecular formula C29H31F2N3O6 and a molecular weight of 555.58 g/mol. Its IUPAC name is 2-[6-fluoro-5-[4-[6-fluoro-5-hydroxy-2-methyl-1-[2-(methylamino)ethyl]indol-3-yl]-3-methoxybut-2-enoyl]oxy-1,2-dimethylindol-3-yl]acetic acid.
| Compound Name | 2-[6-fluoro-5-[4-[6-fluoro-5-hydroxy-2-methyl-1-[2-(methylamino)ethyl]indol-3-yl]-3-methoxybut-2-enoyl]oxy-1,2-dimethylindol-3-yl]acetic acid |
|---|---|
| PubChem CID | 91590265 |
| Molecular Formula | C29H31F2N3O6 |
| Molecular Weight | 555.58 g/mol |
| Exact Mass | 555.22 |
| IUPAC Name | 2-[6-fluoro-5-[4-[6-fluoro-5-hydroxy-2-methyl-1-[2-(methylamino)ethyl]indol-3-yl]-3-methoxybut-2-enoyl]oxy-1,2-dimethylindol-3-yl]acetic acid |
| SMILES | CNCCn1c(C)c(CC(=CC(=O)Oc2cc3c(CC(=O)O)c(C)n(C)c3cc2F)OC)c2cc(O)c(F)cc21 |
| InChI | InChI=1S/C29H31F2N3O6/c1-15-19(12-28(36)37)21-11-27(23(31)14-24(21)33(15)4)40-29(38)9-17(39-5)8-18-16(2)34(7-6-32-3)25-13-22(30)26(35)10-20(18)25/h9-11,13-14,32,35H,6-8,12H2,1-5H3,(H,36,37) |
| InChIKey | HNCQHMYLYULNHA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 114.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.58 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|