C24H23N3O5S — CID 91596185
N-[3-(3-hydroxyphenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1,3-benzothiazole-5-carboxamide (PubChem CID 91596185) has the molecular formula C24H23N3O5S and a molecular weight of 465.53 g/mol. Its IUPAC name is N-[3-(3-hydroxyphenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1,3-benzothiazole-5-carboxamide.
| Compound Name | N-[3-(3-hydroxyphenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1,3-benzothiazole-5-carboxamide |
|---|---|
| PubChem CID | 91596185 |
| Molecular Formula | C24H23N3O5S |
| Molecular Weight | 465.53 g/mol |
| Exact Mass | 465.14 |
| IUPAC Name | N-[3-(3-hydroxyphenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1,3-benzothiazole-5-carboxamide |
| SMILES | O=C(NC(Cc1cccc(O)c1)C(=O)NC12CCCC1OCC2=O)c1ccc2scnc2c1 |
| InChI | InChI=1S/C24H23N3O5S/c28-16-4-1-3-14(9-16)10-18(23(31)27-24-8-2-5-21(24)32-12-20(24)29)26-22(30)15-6-7-19-17(11-15)25-13-33-19/h1,3-4,6-7,9,11,13,18,21,28H,2,5,8,10,12H2,(H,26,30)(H,27,31) |
| InChIKey | GFIXWCMFTIXDJP-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 117.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.53 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |