C25H22Cl2N2O4S — CID 91027622
N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1-benzothiophene-3-carboxamide (PubChem CID 91027622) has the molecular formula C25H22Cl2N2O4S and a molecular weight of 517.43 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 91027622 |
| Molecular Formula | C25H22Cl2N2O4S |
| Molecular Weight | 517.43 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-1-benzothiophene-3-carboxamide |
| SMILES | O=C(NC(Cc1ccc(Cl)c(Cl)c1)C(=O)NC12CCCC1OCC2=O)c1csc2ccccc12 |
| InChI | InChI=1S/C25H22Cl2N2O4S/c26-17-8-7-14(10-18(17)27)11-19(24(32)29-25-9-3-6-22(25)33-12-21(25)30)28-23(31)16-13-34-20-5-2-1-4-15(16)20/h1-2,4-5,7-8,10,13,19,22H,3,6,9,11-12H2,(H,28,31)(H,29,32) |
| InChIKey | TYHHXTAGDGITLP-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.43 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |