C25H22Cl2N4O4S — CID 91031307
N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide (PubChem CID 91031307) has the molecular formula C25H22Cl2N4O4S and a molecular weight of 545.45 g/mol. Its IUPAC name is N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide.
| Compound Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 91031307 |
| Molecular Formula | C25H22Cl2N4O4S |
| Molecular Weight | 545.45 g/mol |
| Exact Mass | 544.07 |
| IUPAC Name | N-[3-(3,4-dichlorophenyl)-1-oxo-1-[(3-oxo-4,5,6,6a-tetrahydrocyclopenta[b]furan-3a-yl)amino]propan-2-yl]-2-pyridin-3-yl-1,3-thiazole-4-carboxamide |
| SMILES | O=C(NC(Cc1ccc(Cl)c(Cl)c1)C(=O)NC12CCCC1OCC2=O)c1csc(-c2cccnc2)n1 |
| InChI | InChI=1S/C25H22Cl2N4O4S/c26-16-6-5-14(9-17(16)27)10-18(23(34)31-25-7-1-4-21(25)35-12-20(25)32)29-22(33)19-13-36-24(30-19)15-3-2-8-28-11-15/h2-3,5-6,8-9,11,13,18,21H,1,4,7,10,12H2,(H,29,33)(H,31,34) |
| InChIKey | YSSJOTJSUYNVNB-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 110.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |