C20H13ClFNOS — CID 91596557
3-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]phenol (PubChem CID 91596557) has the molecular formula C20H13ClFNOS and a molecular weight of 369.85 g/mol. Its IUPAC name is 3-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]phenol.
| Compound Name | 3-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]phenol |
|---|---|
| PubChem CID | 91596557 |
| Molecular Formula | C20H13ClFNOS |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.04 |
| IUPAC Name | 3-[1,3-benzothiazol-6-yl-(2-chlorophenyl)-fluoromethyl]phenol |
| SMILES | Oc1cccc(C(F)(c2ccc3ncsc3c2)c2ccccc2Cl)c1 |
| InChI | InChI=1S/C20H13ClFNOS/c21-17-7-2-1-6-16(17)20(22,13-4-3-5-15(24)10-13)14-8-9-18-19(11-14)25-12-23-18/h1-12,24H |
| InChIKey | AKMICGKTATVRKL-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|