C22H16O7 — CID 91597978
[2-[4-(2-carboxyoxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]phenyl] hydrogen carbonate (PubChem CID 91597978) has the molecular formula C22H16O7 and a molecular weight of 392.36 g/mol. Its IUPAC name is [2-[4-(2-carboxyoxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]phenyl] hydrogen carbonate.
| Compound Name | [2-[4-(2-carboxyoxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]phenyl] hydrogen carbonate |
|---|---|
| PubChem CID | 91597978 |
| Molecular Formula | C22H16O7 |
| Molecular Weight | 392.36 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | [2-[4-(2-carboxyoxyphenyl)-2,3-dihydro-1-benzofuran-6-yl]phenyl] hydrogen carbonate |
| SMILES | O=C(O)Oc1ccccc1-c1cc2c(c(-c3ccccc3OC(=O)O)c1)CCO2 |
| InChI | InChI=1S/C22H16O7/c23-21(24)28-18-7-3-1-5-14(18)13-11-17(16-9-10-27-20(16)12-13)15-6-2-4-8-19(15)29-22(25)26/h1-8,11-12H,9-10H2,(H,23,24)(H,25,26) |
| InChIKey | UFQPGZALPGVGOI-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.36 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|