C28H34O8S6 — CID 91598090
bis[3-(1,3-dithiolan-2-ylmethylsulfanyl)-2-prop-2-enoyloxypropyl] benzene-1,4-dicarboxylate (PubChem CID 91598090) has the molecular formula C28H34O8S6 and a molecular weight of 690.97 g/mol. Its IUPAC name is bis[3-(1,3-dithiolan-2-ylmethylsulfanyl)-2-prop-2-enoyloxypropyl] benzene-1,4-dicarboxylate.
| Compound Name | bis[3-(1,3-dithiolan-2-ylmethylsulfanyl)-2-prop-2-enoyloxypropyl] benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 91598090 |
| Molecular Formula | C28H34O8S6 |
| Molecular Weight | 690.97 g/mol |
| Exact Mass | 690.06 |
| IUPAC Name | bis[3-(1,3-dithiolan-2-ylmethylsulfanyl)-2-prop-2-enoyloxypropyl] benzene-1,4-dicarboxylate |
| SMILES | C=CC(=O)OC(COC(=O)c1ccc(C(=O)OCC(CSCC2SCCS2)OC(=O)C=C)cc1)CSCC1SCCS1 |
| InChI | InChI=1S/C28H34O8S6/c1-3-23(29)35-21(15-37-17-25-39-9-10-40-25)13-33-27(31)19-5-7-20(8-6-19)28(32)34-14-22(36-24(30)4-2)16-38-18-26-41-11-12-42-26/h3-8,21-22,25-26H,1-2,9-18H2 |
| InChIKey | TUCVKKSIKAEBFR-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 690.97 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|