C32H34O12S4 — CID 23389915
[3-[6-[[3-(1,3-dithiolane-2-carbonyloxy)-2-prop-2-enoyloxypropyl]peroxymethyl]naphthalene-2-carbonyl]oxy-2-prop-2-enoyloxypropyl] 1,3-dithiolane-2-carboxylate (PubChem CID 23389915) has the molecular formula C32H34O12S4 and a molecular weight of 738.88 g/mol. Its IUPAC name is [3-[6-[[3-(1,3-dithiolane-2-carbonyloxy)-2-prop-2-enoyloxypropyl]peroxymethyl]naphthalene-2-carbonyl]oxy-2-prop-2-enoyloxypropyl] 1,3-dithiolane-2-carboxylate.
| Compound Name | [3-[6-[[3-(1,3-dithiolane-2-carbonyloxy)-2-prop-2-enoyloxypropyl]peroxymethyl]naphthalene-2-carbonyl]oxy-2-prop-2-enoyloxypropyl] 1,3-dithiolane-2-carboxylate |
|---|---|
| PubChem CID | 23389915 |
| Molecular Formula | C32H34O12S4 |
| Molecular Weight | 738.88 g/mol |
| Exact Mass | 738.09 |
| IUPAC Name | [3-[6-[[3-(1,3-dithiolane-2-carbonyloxy)-2-prop-2-enoyloxypropyl]peroxymethyl]naphthalene-2-carbonyl]oxy-2-prop-2-enoyloxypropyl] 1,3-dithiolane-2-carboxylate |
| SMILES | C=CC(=O)OC(COOCc1ccc2cc(C(=O)OCC(COC(=O)C3SCCS3)OC(=O)C=C)ccc2c1)COC(=O)C1SCCS1 |
| InChI | InChI=1S/C32H34O12S4/c1-3-26(33)43-24(17-39-29(36)31-45-9-10-46-31)16-38-28(35)23-8-7-21-13-20(5-6-22(21)14-23)15-41-42-19-25(44-27(34)4-2)18-40-30(37)32-47-11-12-48-32/h3-8,13-14,24-25,31-32H,1-2,9-12,15-19H2 |
| InChIKey | JJUILYFILQGMSW-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.88 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|