C19H20N4O4S — CID 9159938
2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-(4-nitrophenyl)sulfanylacetyl]acetohydrazide (PubChem CID 9159938) has the molecular formula C19H20N4O4S and a molecular weight of 400.46 g/mol. Its IUPAC name is 2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-(4-nitrophenyl)sulfanylacetyl]acetohydrazide.
| Compound Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-(4-nitrophenyl)sulfanylacetyl]acetohydrazide |
|---|---|
| PubChem CID | 9159938 |
| Molecular Formula | C19H20N4O4S |
| Molecular Weight | 400.46 g/mol |
| Exact Mass | 400.12 |
| IUPAC Name | 2-(3,4-dihydro-2H-quinolin-1-yl)-N'-[2-(4-nitrophenyl)sulfanylacetyl]acetohydrazide |
| SMILES | O=C(CSc1ccc([N+](=O)[O-])cc1)NNC(=O)CN1CCCc2ccccc21 |
| InChI | InChI=1S/C19H20N4O4S/c24-18(12-22-11-3-5-14-4-1-2-6-17(14)22)20-21-19(25)13-28-16-9-7-15(8-10-16)23(26)27/h1-2,4,6-10H,3,5,11-13H2,(H,20,24)(H,21,25) |
| InChIKey | PECHAQDAQREWCR-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 104.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|