C12H15NO7S — CID 91599785
1-[(2,5-dioxopyrrol-1-yl)methyl]-2-sulfocyclohexane-1-carboxylic acid (PubChem CID 91599785) has the molecular formula C12H15NO7S and a molecular weight of 317.32 g/mol. Its IUPAC name is 1-[(2,5-dioxopyrrol-1-yl)methyl]-2-sulfocyclohexane-1-carboxylic acid.
| Compound Name | 1-[(2,5-dioxopyrrol-1-yl)methyl]-2-sulfocyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 91599785 |
| Molecular Formula | C12H15NO7S |
| Molecular Weight | 317.32 g/mol |
| Exact Mass | 317.06 |
| IUPAC Name | 1-[(2,5-dioxopyrrol-1-yl)methyl]-2-sulfocyclohexane-1-carboxylic acid |
| SMILES | O=C1C=CC(=O)N1CC1(C(=O)O)CCCCC1S(=O)(=O)O |
| InChI | InChI=1S/C12H15NO7S/c14-9-4-5-10(15)13(9)7-12(11(16)17)6-2-1-3-8(12)21(18,19)20/h4-5,8H,1-3,6-7H2,(H,16,17)(H,18,19,20) |
| InChIKey | AIJXXWFEZXHHRL-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 129.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.32 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|