C22H20N2O3 — CID 91604763
3-[2-(1H-indol-3-yl)acetyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione (PubChem CID 91604763) has the molecular formula C22H20N2O3 and a molecular weight of 360.41 g/mol. Its IUPAC name is 3-[2-(1H-indol-3-yl)acetyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione.
| Compound Name | 3-[2-(1H-indol-3-yl)acetyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione |
|---|---|
| PubChem CID | 91604763 |
| Molecular Formula | C22H20N2O3 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.15 |
| IUPAC Name | 3-[2-(1H-indol-3-yl)acetyl]-5-(2-phenylethyl)pyrrolidine-2,4-dione |
| SMILES | O=C(Cc1c[nH]c2ccccc12)C1C(=O)NC(CCc2ccccc2)C1=O |
| InChI | InChI=1S/C22H20N2O3/c25-19(12-15-13-23-17-9-5-4-8-16(15)17)20-21(26)18(24-22(20)27)11-10-14-6-2-1-3-7-14/h1-9,13,18,20,23H,10-12H2,(H,24,27) |
| InChIKey | RHLLYYIGGOKCKY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|