About [methylidene(propyl)-λ4-sulfanyl]formaldehyde
[methylidene(propyl)-λ4-sulfanyl]formaldehyde (PubChem CID 91605387) has the molecular formula C5H10OS
and a molecular weight of 118.20 g/mol. Its IUPAC name is [methylidene(propyl)-λ4-sulfanyl]formaldehyde.
Molecular Properties
| Compound Name | [methylidene(propyl)-λ4-sulfanyl]formaldehyde |
| PubChem CID | 91605387 |
| Molecular Formula | C5H10OS |
| Molecular Weight | 118.20 g/mol |
| Exact Mass | 118.05 |
| IUPAC Name | [methylidene(propyl)-λ4-sulfanyl]formaldehyde |
| SMILES | C=S(C=O)CCC |
| InChI | InChI=1S/C5H10OS/c1-3-4-7(2)5-6/h5H,2-4H2,1H3 |
| InChIKey | UKOBOTTXHOKRKK-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 118.20 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze [methylidene(propyl)-λ4-sulfanyl]formaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methylidene(propyl)-λ4-sulfanyl]formaldehyde?
The IUPAC name of [methylidene(propyl)-λ4-sulfanyl]formaldehyde (CID 91605387) is [methylidene(propyl)-λ4-sulfanyl]formaldehyde.
What is the SMILES notation for [methylidene(propyl)-λ4-sulfanyl]formaldehyde?
The canonical SMILES for [methylidene(propyl)-λ4-sulfanyl]formaldehyde is C=S(C=O)CCC.
What is the InChIKey of [methylidene(propyl)-λ4-sulfanyl]formaldehyde?
The InChIKey is UKOBOTTXHOKRKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10OS/c1-3-4-7(2)5-6/h5H,2-4H2,1H3.
What are the key properties of [methylidene(propyl)-λ4-sulfanyl]formaldehyde?
[methylidene(propyl)-λ4-sulfanyl]formaldehyde has a molecular weight of 118.20 g/mol, XLogP of 1.29, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [methylidene(propyl)-λ4-sulfanyl]formaldehyde is sourced from PubChem (CID 91605387), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).