About azanylidyne-oxo-propyl-λ6-sulfane
azanylidyne-oxo-propyl-λ6-sulfane (PubChem CID 90138662) has the molecular formula C3H7NOS
and a molecular weight of 105.16 g/mol. Its IUPAC name is azanylidyne-oxo-propyl-λ6-sulfane.
Molecular Properties
| Compound Name | azanylidyne-oxo-propyl-λ6-sulfane |
| PubChem CID | 90138662 |
| Molecular Formula | C3H7NOS |
| Molecular Weight | 105.16 g/mol |
| Exact Mass | 105.02 |
| IUPAC Name | azanylidyne-oxo-propyl-λ6-sulfane |
| SMILES | CCCS(#N)=O |
| InChI | InChI=1S/C3H7NOS/c1-2-3-6(4)5/h2-3H2,1H3 |
| InChIKey | JRMRUFQTQMPLSK-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 105.16 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azanylidyne-oxo-propyl-λ6-sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azanylidyne-oxo-propyl-λ6-sulfane?
The IUPAC name of azanylidyne-oxo-propyl-λ6-sulfane (CID 90138662) is azanylidyne-oxo-propyl-λ6-sulfane.
What is the SMILES notation for azanylidyne-oxo-propyl-λ6-sulfane?
The canonical SMILES for azanylidyne-oxo-propyl-λ6-sulfane is CCCS(#N)=O.
What is the InChIKey of azanylidyne-oxo-propyl-λ6-sulfane?
The InChIKey is JRMRUFQTQMPLSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7NOS/c1-2-3-6(4)5/h2-3H2,1H3.
What are the key properties of azanylidyne-oxo-propyl-λ6-sulfane?
azanylidyne-oxo-propyl-λ6-sulfane has a molecular weight of 105.16 g/mol, XLogP of 0.62, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azanylidyne-oxo-propyl-λ6-sulfane is sourced from PubChem (CID 90138662), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).