About ethyl (R)-butane-1-sulfinate
ethyl (R)-butane-1-sulfinate (PubChem CID 175883335) has the molecular formula C6H14O2S
and a molecular weight of 150.24 g/mol. Its IUPAC name is ethyl (R)-butane-1-sulfinate.
Molecular Properties
| Compound Name | ethyl (R)-butane-1-sulfinate |
| PubChem CID | 175883335 |
| Molecular Formula | C6H14O2S |
| Molecular Weight | 150.24 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | ethyl (R)-butane-1-sulfinate |
| SMILES | CCCC[S@](=O)OCC |
| InChI | InChI=1S/C6H14O2S/c1-3-5-6-9(7)8-4-2/h3-6H2,1-2H3/t9-/m1/s1 |
| InChIKey | UPCHWHSGSGLGGA-SECBINFHSA-N |
| XLogP | 1.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.24 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethyl (R)-butane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (R)-butane-1-sulfinate?
The IUPAC name of ethyl (R)-butane-1-sulfinate (CID 175883335) is ethyl (R)-butane-1-sulfinate.
What is the SMILES notation for ethyl (R)-butane-1-sulfinate?
The canonical SMILES for ethyl (R)-butane-1-sulfinate is CCCC[S@](=O)OCC.
What is the InChIKey of ethyl (R)-butane-1-sulfinate?
The InChIKey is UPCHWHSGSGLGGA-SECBINFHSA-N. The full InChI is InChI=1S/C6H14O2S/c1-3-5-6-9(7)8-4-2/h3-6H2,1-2H3/t9-/m1/s1.
What are the key properties of ethyl (R)-butane-1-sulfinate?
ethyl (R)-butane-1-sulfinate has a molecular weight of 150.24 g/mol, XLogP of 1.49, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (R)-butane-1-sulfinate is sourced from PubChem (CID 175883335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).