About ethyl tridecane-1-sulfinate
ethyl tridecane-1-sulfinate (PubChem CID 174876720) has the molecular formula C15H32O2S
and a molecular weight of 276.49 g/mol. Its IUPAC name is ethyl tridecane-1-sulfinate.
Molecular Properties
| Compound Name | ethyl tridecane-1-sulfinate |
| PubChem CID | 174876720 |
| Molecular Formula | C15H32O2S |
| Molecular Weight | 276.49 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | ethyl tridecane-1-sulfinate |
| SMILES | CCCCCCCCCCCCCS(=O)OCC |
| InChI | InChI=1S/C15H32O2S/c1-3-5-6-7-8-9-10-11-12-13-14-15-18(16)17-4-2/h3-15H2,1-2H3 |
| InChIKey | XIBSNWLNZZZCTB-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethyl tridecane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl tridecane-1-sulfinate?
The IUPAC name of ethyl tridecane-1-sulfinate (CID 174876720) is ethyl tridecane-1-sulfinate.
What is the SMILES notation for ethyl tridecane-1-sulfinate?
The canonical SMILES for ethyl tridecane-1-sulfinate is CCCCCCCCCCCCCS(=O)OCC.
What is the InChIKey of ethyl tridecane-1-sulfinate?
The InChIKey is XIBSNWLNZZZCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H32O2S/c1-3-5-6-7-8-9-10-11-12-13-14-15-18(16)17-4-2/h3-15H2,1-2H3.
What are the key properties of ethyl tridecane-1-sulfinate?
ethyl tridecane-1-sulfinate has a molecular weight of 276.49 g/mol, XLogP of 5.00, 14 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl tridecane-1-sulfinate is sourced from PubChem (CID 174876720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).