About fluoro butane-1-sulfinate
fluoro butane-1-sulfinate (PubChem CID 86758562) has the molecular formula C4H9FO2S
and a molecular weight of 140.18 g/mol. Its IUPAC name is fluoro butane-1-sulfinate.
Molecular Properties
| Compound Name | fluoro butane-1-sulfinate |
| PubChem CID | 86758562 |
| Molecular Formula | C4H9FO2S |
| Molecular Weight | 140.18 g/mol |
| Exact Mass | 140.03 |
| IUPAC Name | fluoro butane-1-sulfinate |
| SMILES | CCCCS(=O)OF |
| InChI | InChI=1S/C4H9FO2S/c1-2-3-4-8(6)7-5/h2-4H2,1H3 |
| InChIKey | AAFRWOZIOHGYRT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.18 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze fluoro butane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluoro butane-1-sulfinate?
The IUPAC name of fluoro butane-1-sulfinate (CID 86758562) is fluoro butane-1-sulfinate.
What is the SMILES notation for fluoro butane-1-sulfinate?
The canonical SMILES for fluoro butane-1-sulfinate is CCCCS(=O)OF.
What is the InChIKey of fluoro butane-1-sulfinate?
The InChIKey is AAFRWOZIOHGYRT-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9FO2S/c1-2-3-4-8(6)7-5/h2-4H2,1H3.
What are the key properties of fluoro butane-1-sulfinate?
fluoro butane-1-sulfinate has a molecular weight of 140.18 g/mol, XLogP of 1.35, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for fluoro butane-1-sulfinate is sourced from PubChem (CID 86758562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).