About azane;fluoro propane-1-sulfinate
azane;fluoro propane-1-sulfinate (PubChem CID 174229843) has the molecular formula C3H10FNO2S
and a molecular weight of 143.18 g/mol. Its IUPAC name is azane;fluoro propane-1-sulfinate.
Molecular Properties
| Compound Name | azane;fluoro propane-1-sulfinate |
| PubChem CID | 174229843 |
| Molecular Formula | C3H10FNO2S |
| Molecular Weight | 143.18 g/mol |
| Exact Mass | 143.04 |
| IUPAC Name | azane;fluoro propane-1-sulfinate |
| SMILES | CCCS(=O)OF.N |
| InChI | InChI=1S/C3H7FO2S.H3N/c1-2-3-7(5)6-4;/h2-3H2,1H3;1H3 |
| InChIKey | ODAYZROQBKVRBQ-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 61.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 143.18 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze azane;fluoro propane-1-sulfinate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;fluoro propane-1-sulfinate?
The IUPAC name of azane;fluoro propane-1-sulfinate (CID 174229843) is azane;fluoro propane-1-sulfinate.
What is the SMILES notation for azane;fluoro propane-1-sulfinate?
The canonical SMILES for azane;fluoro propane-1-sulfinate is CCCS(=O)OF.N.
What is the InChIKey of azane;fluoro propane-1-sulfinate?
The InChIKey is ODAYZROQBKVRBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7FO2S.H3N/c1-2-3-7(5)6-4;/h2-3H2,1H3;1H3.
What are the key properties of azane;fluoro propane-1-sulfinate?
azane;fluoro propane-1-sulfinate has a molecular weight of 143.18 g/mol, XLogP of 1.12, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;fluoro propane-1-sulfinate is sourced from PubChem (CID 174229843), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).