About 1-sulfonylpropyl hypofluorite
1-sulfonylpropyl hypofluorite (PubChem CID 151411508) has the molecular formula C3H5FO3S
and a molecular weight of 140.13 g/mol. Its IUPAC name is 1-sulfonylpropyl hypofluorite.
Molecular Properties
| Compound Name | 1-sulfonylpropyl hypofluorite |
| PubChem CID | 151411508 |
| Molecular Formula | C3H5FO3S |
| Molecular Weight | 140.13 g/mol |
| Exact Mass | 139.99 |
| IUPAC Name | 1-sulfonylpropyl hypofluorite |
| SMILES | CCC(OF)=S(=O)=O |
| InChI | InChI=1S/C3H5FO3S/c1-2-3(7-4)8(5)6/h2H2,1H3 |
| InChIKey | OYPVKPATSUKHJI-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 140.13 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfonylpropyl hypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfonylpropyl hypofluorite?
The IUPAC name of 1-sulfonylpropyl hypofluorite (CID 151411508) is 1-sulfonylpropyl hypofluorite.
What is the SMILES notation for 1-sulfonylpropyl hypofluorite?
The canonical SMILES for 1-sulfonylpropyl hypofluorite is CCC(OF)=S(=O)=O.
What is the InChIKey of 1-sulfonylpropyl hypofluorite?
The InChIKey is OYPVKPATSUKHJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5FO3S/c1-2-3(7-4)8(5)6/h2H2,1H3.
What are the key properties of 1-sulfonylpropyl hypofluorite?
1-sulfonylpropyl hypofluorite has a molecular weight of 140.13 g/mol, XLogP of 0.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfonylpropyl hypofluorite is sourced from PubChem (CID 151411508), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).