About 1,2-disulfonylbutane
1,2-disulfonylbutane (PubChem CID 170552045) has the molecular formula C4H6O4S2
and a molecular weight of 182.22 g/mol. Its IUPAC name is 1,2-disulfonylbutane.
Molecular Properties
| Compound Name | 1,2-disulfonylbutane |
| PubChem CID | 170552045 |
| Molecular Formula | C4H6O4S2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 181.97 |
| IUPAC Name | 1,2-disulfonylbutane |
| SMILES | CCC(C=S(=O)=O)=S(=O)=O |
| InChI | InChI=1S/C4H6O4S2/c1-2-4(10(7)8)3-9(5)6/h3H,2H2,1H3 |
| InChIKey | SLHGUWKUBXGBJM-UHFFFAOYSA-N |
| XLogP | -0.87 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,2-disulfonylbutane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-disulfonylbutane?
The IUPAC name of 1,2-disulfonylbutane (CID 170552045) is 1,2-disulfonylbutane.
What is the SMILES notation for 1,2-disulfonylbutane?
The canonical SMILES for 1,2-disulfonylbutane is CCC(C=S(=O)=O)=S(=O)=O.
What is the InChIKey of 1,2-disulfonylbutane?
The InChIKey is SLHGUWKUBXGBJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H6O4S2/c1-2-4(10(7)8)3-9(5)6/h3H,2H2,1H3.
What are the key properties of 1,2-disulfonylbutane?
1,2-disulfonylbutane has a molecular weight of 182.22 g/mol, XLogP of -0.87, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-disulfonylbutane is sourced from PubChem (CID 170552045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).