C13H16N2O — CID 91609134
1-(2-methoxy-4-methylphenyl)-2,4-dimethylimidazole (PubChem CID 91609134) has the molecular formula C13H16N2O and a molecular weight of 216.28 g/mol. Its IUPAC name is 1-(2-methoxy-4-methylphenyl)-2,4-dimethylimidazole.
| Compound Name | 1-(2-methoxy-4-methylphenyl)-2,4-dimethylimidazole |
|---|---|
| PubChem CID | 91609134 |
| Molecular Formula | C13H16N2O |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | 1-(2-methoxy-4-methylphenyl)-2,4-dimethylimidazole |
| SMILES | COc1cc(C)ccc1-n1cc(C)nc1C |
| InChI | InChI=1S/C13H16N2O/c1-9-5-6-12(13(7-9)16-4)15-8-10(2)14-11(15)3/h5-8H,1-4H3 |
| InChIKey | PVTNRUMYFQSUGI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |