C16H24FN3O3 — CID 143812513
ethane;1-(5-fluoro-3-methoxy-2-nitrophenyl)-2,4-dimethylimidazole (PubChem CID 143812513) has the molecular formula C16H24FN3O3 and a molecular weight of 325.38 g/mol. Its IUPAC name is ethane;1-(5-fluoro-3-methoxy-2-nitrophenyl)-2,4-dimethylimidazole.
| Compound Name | ethane;1-(5-fluoro-3-methoxy-2-nitrophenyl)-2,4-dimethylimidazole |
|---|---|
| PubChem CID | 143812513 |
| Molecular Formula | C16H24FN3O3 |
| Molecular Weight | 325.38 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | ethane;1-(5-fluoro-3-methoxy-2-nitrophenyl)-2,4-dimethylimidazole |
| SMILES | CC.CC.COc1cc(F)cc(-n2cc(C)nc2C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C12H12FN3O3.2C2H6/c1-7-6-15(8(2)14-7)10-4-9(13)5-11(19-3)12(10)16(17)18;2*1-2/h4-6H,1-3H3;2*1-2H3 |
| InChIKey | PRLNXKSHVAVXAK-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 70.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|