C17H19FN6O3 — CID 71490930
2-[1-(5-fluoro-3-methoxy-2-nitrophenyl)-4-methylimidazol-2-yl]-N,N,5-trimethylpyrazol-3-amine (PubChem CID 71490930) has the molecular formula C17H19FN6O3 and a molecular weight of 374.38 g/mol. Its IUPAC name is 2-[1-(5-fluoro-3-methoxy-2-nitrophenyl)-4-methylimidazol-2-yl]-N,N,5-trimethylpyrazol-3-amine.
| Compound Name | 2-[1-(5-fluoro-3-methoxy-2-nitrophenyl)-4-methylimidazol-2-yl]-N,N,5-trimethylpyrazol-3-amine |
|---|---|
| PubChem CID | 71490930 |
| Molecular Formula | C17H19FN6O3 |
| Molecular Weight | 374.38 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | 2-[1-(5-fluoro-3-methoxy-2-nitrophenyl)-4-methylimidazol-2-yl]-N,N,5-trimethylpyrazol-3-amine |
| SMILES | COc1cc(F)cc(-n2cc(C)nc2-n2nc(C)cc2N(C)C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C17H19FN6O3/c1-10-6-15(21(3)4)23(20-10)17-19-11(2)9-22(17)13-7-12(18)8-14(27-5)16(13)24(25)26/h6-9H,1-5H3 |
| InChIKey | RGOLOFAOOQPGHR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 91.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|