C29H28F4O6S — CID 91609309
[3,3,4,4-tetrafluoro-4-[3-(1-phenylocta-3,5-dienyl)phenoxy]sulfonylbutyl] furan-2-carboxylate (PubChem CID 91609309) has the molecular formula C29H28F4O6S and a molecular weight of 580.60 g/mol. Its IUPAC name is [3,3,4,4-tetrafluoro-4-[3-(1-phenylocta-3,5-dienyl)phenoxy]sulfonylbutyl] furan-2-carboxylate.
| Compound Name | [3,3,4,4-tetrafluoro-4-[3-(1-phenylocta-3,5-dienyl)phenoxy]sulfonylbutyl] furan-2-carboxylate |
|---|---|
| PubChem CID | 91609309 |
| Molecular Formula | C29H28F4O6S |
| Molecular Weight | 580.60 g/mol |
| Exact Mass | 580.15 |
| IUPAC Name | [3,3,4,4-tetrafluoro-4-[3-(1-phenylocta-3,5-dienyl)phenoxy]sulfonylbutyl] furan-2-carboxylate |
| SMILES | CCC=CC=CCC(c1ccccc1)c1cccc(OS(=O)(=O)C(F)(F)C(F)(F)CCOC(=O)c2ccco2)c1 |
| InChI | InChI=1S/C29H28F4O6S/c1-2-3-4-5-9-16-25(22-12-7-6-8-13-22)23-14-10-15-24(21-23)39-40(35,36)29(32,33)28(30,31)18-20-38-27(34)26-17-11-19-37-26/h3-15,17,19,21,25H,2,16,18,20H2,1H3 |
| InChIKey | BITRTCYNPVDMJH-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 82.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 580.60 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|