C8H13F3S — CID 91609738
1,1,4-trifluoro-2-methyl-4-propylsulfanylbut-2-ene (PubChem CID 91609738) has the molecular formula C8H13F3S and a molecular weight of 198.25 g/mol. Its IUPAC name is 1,1,4-trifluoro-2-methyl-4-propylsulfanylbut-2-ene.
| Compound Name | 1,1,4-trifluoro-2-methyl-4-propylsulfanylbut-2-ene |
|---|---|
| PubChem CID | 91609738 |
| Molecular Formula | C8H13F3S |
| Molecular Weight | 198.25 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | 1,1,4-trifluoro-2-methyl-4-propylsulfanylbut-2-ene |
| SMILES | CCCSC(F)C=C(C)C(F)F |
| InChI | InChI=1S/C8H13F3S/c1-3-4-12-7(9)5-6(2)8(10)11/h5,7-8H,3-4H2,1-2H3 |
| InChIKey | CBOYEKUXWVPOOD-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|