C19H20FN5O5S — CID 91614043
7-[3-(aminomethyl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-9-cyclopropyl-6-fluoro-1,1-dioxo-[1,2]thiazolo[5,4-b]quinoline-3,4-dione (PubChem CID 91614043) has the molecular formula C19H20FN5O5S and a molecular weight of 449.46 g/mol. Its IUPAC name is 7-[3-(aminomethyl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-9-cyclopropyl-6-fluoro-1,1-dioxo-[1,2]thiazolo[5,4-b]quinoline-3,4-dione.
| Compound Name | 7-[3-(aminomethyl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-9-cyclopropyl-6-fluoro-1,1-dioxo-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
|---|---|
| PubChem CID | 91614043 |
| Molecular Formula | C19H20FN5O5S |
| Molecular Weight | 449.46 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | 7-[3-(aminomethyl)-4-(methoxyamino)-2,3-dihydropyrrol-1-yl]-9-cyclopropyl-6-fluoro-1,1-dioxo-[1,2]thiazolo[5,4-b]quinoline-3,4-dione |
| SMILES | CONC1=CN(c2cc3c(cc2F)c(=O)c2c(n3C3CC3)S(=O)(=O)NC2=O)CC1CN |
| InChI | InChI=1S/C19H20FN5O5S/c1-30-22-13-8-24(7-9(13)6-21)15-5-14-11(4-12(15)20)17(26)16-18(27)23-31(28,29)19(16)25(14)10-2-3-10/h4-5,8-10,22H,2-3,6-7,21H2,1H3,(H,23,27) |
| InChIKey | SEUWYWCXARVXPR-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 135.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.46 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|