C56H40N6O2 — CID 91614425
2-[[2-[[2-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanone (PubChem CID 91614425) has the molecular formula C56H40N6O2 and a molecular weight of 828.98 g/mol. Its IUPAC name is 2-[[2-[[2-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanone.
| Compound Name | 2-[[2-[[2-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanone |
|---|---|
| PubChem CID | 91614425 |
| Molecular Formula | C56H40N6O2 |
| Molecular Weight | 828.98 g/mol |
| Exact Mass | 828.32 |
| IUPAC Name | 2-[[2-[[2-[(2-oxo-1,2-diphenylethylidene)hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethylidene]hydrazinylidene]-1,2-diphenylethanone |
| SMILES | O=C(C(=NN=C(C(=NN=C(C(=NN=C(C(=O)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C56H40N6O2/c63-55(47-37-21-7-22-38-47)53(45-33-17-5-18-34-45)61-59-51(43-29-13-3-14-30-43)49(41-25-9-1-10-26-41)57-58-50(42-27-11-2-12-28-42)52(44-31-15-4-16-32-44)60-62-54(46-35-19-6-20-36-46)56(64)48-39-23-8-24-40-48/h1-40H |
| InChIKey | ZMKZWKWWUFMWKU-UHFFFAOYSA-N |
| XLogP | 11.43 |
| TPSA | 108.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.98 |
| LogP ≤ 5 | 11.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|