C6H9N — CID 91614892
(4Z)-hexa-1,4-dien-3-imine (PubChem CID 91614892) has the molecular formula C6H9N and a molecular weight of 95.14 g/mol. Its IUPAC name is (4Z)-hexa-1,4-dien-3-imine.
| Compound Name | (4Z)-hexa-1,4-dien-3-imine |
|---|---|
| PubChem CID | 91614892 |
| Molecular Formula | C6H9N |
| Molecular Weight | 95.14 g/mol |
| Exact Mass | 95.07 |
| IUPAC Name | (4Z)-hexa-1,4-dien-3-imine |
| SMILES | [H]/N=C(C=C)/C=C\C |
| InChI | InChI=1S/C6H9N/c1-3-5-6(7)4-2/h3-5,7H,2H2,1H3/b5-3-,7-6+ |
| InChIKey | CHKOZYSXTAFVAX-AIJKMKQJSA-N |
| XLogP | 1.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 95.14 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|