C9H18O2 — CID 91615806
3-methoxy-2,5-dimethylhex-5-en-1-ol (PubChem CID 91615806) has the molecular formula C9H18O2 and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-methoxy-2,5-dimethylhex-5-en-1-ol.
| Compound Name | 3-methoxy-2,5-dimethylhex-5-en-1-ol |
|---|---|
| PubChem CID | 91615806 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 3-methoxy-2,5-dimethylhex-5-en-1-ol |
| SMILES | C=C(C)CC(OC)C(C)CO |
| InChI | InChI=1S/C9H18O2/c1-7(2)5-9(11-4)8(3)6-10/h8-10H,1,5-6H2,2-4H3 |
| InChIKey | TTXXWXIATRVNMD-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|