About 3-methylhexan-2-ol;pyridine
3-methylhexan-2-ol;pyridine (PubChem CID 91616825) has the molecular formula C12H21NO
and a molecular weight of 195.31 g/mol. Its IUPAC name is 3-methylhexan-2-ol;pyridine.
Molecular Properties
| Compound Name | 3-methylhexan-2-ol;pyridine |
| PubChem CID | 91616825 |
| Molecular Formula | C12H21NO |
| Molecular Weight | 195.31 g/mol |
| Exact Mass | 195.16 |
| IUPAC Name | 3-methylhexan-2-ol;pyridine |
| SMILES | CCCC(C)C(C)O.c1ccncc1 |
| InChI | InChI=1S/C7H16O.C5H5N/c1-4-5-6(2)7(3)8;1-2-4-6-5-3-1/h6-8H,4-5H2,1-3H3;1-5H |
| InChIKey | VDZQUSOKLIUKBM-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.31 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methylhexan-2-ol;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylhexan-2-ol;pyridine?
The IUPAC name of 3-methylhexan-2-ol;pyridine (CID 91616825) is 3-methylhexan-2-ol;pyridine.
What is the SMILES notation for 3-methylhexan-2-ol;pyridine?
The canonical SMILES for 3-methylhexan-2-ol;pyridine is CCCC(C)C(C)O.c1ccncc1.
What is the InChIKey of 3-methylhexan-2-ol;pyridine?
The InChIKey is VDZQUSOKLIUKBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16O.C5H5N/c1-4-5-6(2)7(3)8;1-2-4-6-5-3-1/h6-8H,4-5H2,1-3H3;1-5H.
What are the key properties of 3-methylhexan-2-ol;pyridine?
3-methylhexan-2-ol;pyridine has a molecular weight of 195.31 g/mol, XLogP of 2.88, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylhexan-2-ol;pyridine is sourced from PubChem (CID 91616825), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).