About acetic acid;2-chloropentanoic acid;pyridine
acetic acid;2-chloropentanoic acid;pyridine (PubChem CID 173457755) has the molecular formula C12H18ClNO4
and a molecular weight of 275.73 g/mol. Its IUPAC name is acetic acid;2-chloropentanoic acid;pyridine.
Molecular Properties
| Compound Name | acetic acid;2-chloropentanoic acid;pyridine |
| PubChem CID | 173457755 |
| Molecular Formula | C12H18ClNO4 |
| Molecular Weight | 275.73 g/mol |
| Exact Mass | 275.09 |
| IUPAC Name | acetic acid;2-chloropentanoic acid;pyridine |
| SMILES | CC(=O)O.CCCC(Cl)C(=O)O.c1ccncc1 |
| InChI | InChI=1S/C5H9ClO2.C5H5N.C2H4O2/c1-2-3-4(6)5(7)8;1-2-4-6-5-3-1;1-2(3)4/h4H,2-3H2,1H3,(H,7,8);1-5H;1H3,(H,3,4) |
| InChIKey | ISAMNHSRZCEJOG-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.73 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-chloropentanoic acid;pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-chloropentanoic acid;pyridine?
The IUPAC name of acetic acid;2-chloropentanoic acid;pyridine (CID 173457755) is acetic acid;2-chloropentanoic acid;pyridine.
What is the SMILES notation for acetic acid;2-chloropentanoic acid;pyridine?
The canonical SMILES for acetic acid;2-chloropentanoic acid;pyridine is CC(=O)O.CCCC(Cl)C(=O)O.c1ccncc1.
What is the InChIKey of acetic acid;2-chloropentanoic acid;pyridine?
The InChIKey is ISAMNHSRZCEJOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO2.C5H5N.C2H4O2/c1-2-3-4(6)5(7)8;1-2-4-6-5-3-1;1-2(3)4/h4H,2-3H2,1H3,(H,7,8);1-5H;1H3,(H,3,4).
What are the key properties of acetic acid;2-chloropentanoic acid;pyridine?
acetic acid;2-chloropentanoic acid;pyridine has a molecular weight of 275.73 g/mol, XLogP of 2.65, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-chloropentanoic acid;pyridine is sourced from PubChem (CID 173457755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).