C19H16N2O2 — CID 91617079
5-hydroxy-4-naphthalen-1-yl-2,4-diazatricyclo[5.2.2.02,6]undeca-5,8-dien-3-one (PubChem CID 91617079) has the molecular formula C19H16N2O2 and a molecular weight of 304.35 g/mol. Its IUPAC name is 5-hydroxy-4-naphthalen-1-yl-2,4-diazatricyclo[5.2.2.02,6]undeca-5,8-dien-3-one.
| Compound Name | 5-hydroxy-4-naphthalen-1-yl-2,4-diazatricyclo[5.2.2.02,6]undeca-5,8-dien-3-one |
|---|---|
| PubChem CID | 91617079 |
| Molecular Formula | C19H16N2O2 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.12 |
| IUPAC Name | 5-hydroxy-4-naphthalen-1-yl-2,4-diazatricyclo[5.2.2.02,6]undeca-5,8-dien-3-one |
| SMILES | O=c1n(-c2cccc3ccccc23)c(O)c2n1C1C=CC2CC1 |
| InChI | InChI=1S/C19H16N2O2/c22-18-17-13-8-10-14(11-9-13)20(17)19(23)21(18)16-7-3-5-12-4-1-2-6-15(12)16/h1-8,10,13-14,22H,9,11H2 |
| InChIKey | XQYABUNCRADUQP-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 47.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|