C25H14F15N3O3 — CID 91486058
(1R)-5-hydroxy-4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one (PubChem CID 91486058) has the molecular formula C25H14F15N3O3 and a molecular weight of 689.38 g/mol. Its IUPAC name is (1R)-5-hydroxy-4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one.
| Compound Name | (1R)-5-hydroxy-4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
|---|---|
| PubChem CID | 91486058 |
| Molecular Formula | C25H14F15N3O3 |
| Molecular Weight | 689.38 g/mol |
| Exact Mass | 689.08 |
| IUPAC Name | (1R)-5-hydroxy-4-naphthalen-1-yl-8-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctanoyl)-2,4,8-triazatricyclo[5.2.1.02,6]dec-5-en-3-one |
| SMILES | O=C(N1C[C@H]2CC1c1c(O)n(-c3cccc4ccccc34)c(=O)n12)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C25H14F15N3O3/c26-19(27,20(28,29)21(30,31)22(32,33)23(34,35)24(36,37)25(38,39)40)17(45)41-9-11-8-14(41)15-16(44)43(18(46)42(11)15)13-7-3-5-10-4-1-2-6-12(10)13/h1-7,11,14,44H,8-9H2/t11-,14?/m1/s1 |
| InChIKey | WULIRYGFXHCEIF-YNODCEANSA-N |
| XLogP | 6.70 |
| TPSA | 67.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 689.38 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|