C9H14N2O4S — CID 91622040
5-(1-methylimidazol-2-yl)sulfonylpentanoic acid (PubChem CID 91622040) has the molecular formula C9H14N2O4S and a molecular weight of 246.29 g/mol. Its IUPAC name is 5-(1-methylimidazol-2-yl)sulfonylpentanoic acid.
| Compound Name | 5-(1-methylimidazol-2-yl)sulfonylpentanoic acid |
|---|---|
| PubChem CID | 91622040 |
| Molecular Formula | C9H14N2O4S |
| Molecular Weight | 246.29 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 5-(1-methylimidazol-2-yl)sulfonylpentanoic acid |
| SMILES | Cn1ccnc1S(=O)(=O)CCCCC(=O)O |
| InChI | InChI=1S/C9H14N2O4S/c1-11-6-5-10-9(11)16(14,15)7-3-2-4-8(12)13/h5-6H,2-4,7H2,1H3,(H,12,13) |
| InChIKey | NCGNSAPSKCTQHF-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.29 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|