C9H15NO2 — CID 91622642
(1,3-dimethyl-2,6-dihydropyridin-3-yl) acetate (PubChem CID 91622642) has the molecular formula C9H15NO2 and a molecular weight of 169.22 g/mol. Its IUPAC name is (1,3-dimethyl-2,6-dihydropyridin-3-yl) acetate.
| Compound Name | (1,3-dimethyl-2,6-dihydropyridin-3-yl) acetate |
|---|---|
| PubChem CID | 91622642 |
| Molecular Formula | C9H15NO2 |
| Molecular Weight | 169.22 g/mol |
| Exact Mass | 169.11 |
| IUPAC Name | (1,3-dimethyl-2,6-dihydropyridin-3-yl) acetate |
| SMILES | CC(=O)OC1(C)C=CCN(C)C1 |
| InChI | InChI=1S/C9H15NO2/c1-8(11)12-9(2)5-4-6-10(3)7-9/h4-5H,6-7H2,1-3H3 |
| InChIKey | YYDBDUTUZLDYKZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 169.22 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|