C20H24N2O5S — CID 9162349
N-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-2-oxo-2-pyrrolidin-1-ylacetamide (PubChem CID 9162349) has the molecular formula C20H24N2O5S and a molecular weight of 404.49 g/mol. Its IUPAC name is N-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-2-oxo-2-pyrrolidin-1-ylacetamide.
| Compound Name | N-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-2-oxo-2-pyrrolidin-1-ylacetamide |
|---|---|
| PubChem CID | 9162349 |
| Molecular Formula | C20H24N2O5S |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | N-[(2R)-2-(2,5-dimethylphenyl)sulfonyl-2-(furan-2-yl)ethyl]-2-oxo-2-pyrrolidin-1-ylacetamide |
| SMILES | Cc1ccc(C)c(S(=O)(=O)[C@H](CNC(=O)C(=O)N2CCCC2)c2ccco2)c1 |
| InChI | InChI=1S/C20H24N2O5S/c1-14-7-8-15(2)17(12-14)28(25,26)18(16-6-5-11-27-16)13-21-19(23)20(24)22-9-3-4-10-22/h5-8,11-12,18H,3-4,9-10,13H2,1-2H3,(H,21,23)/t18-/m1/s1 |
| InChIKey | CNQZNOKYMAWWRZ-GOSISDBHSA-N |
| XLogP | 2.15 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|