C24H21N3OS — CID 91630384
1-benzhydryl-3-[(2-thiophen-2-yl-4-pyridinyl)methyl]urea (PubChem CID 91630384) has the molecular formula C24H21N3OS and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-benzhydryl-3-[(2-thiophen-2-yl-4-pyridinyl)methyl]urea.
| Compound Name | 1-benzhydryl-3-[(2-thiophen-2-yl-4-pyridinyl)methyl]urea |
|---|---|
| PubChem CID | 91630384 |
| Molecular Formula | C24H21N3OS |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | 1-benzhydryl-3-[(2-thiophen-2-yl-4-pyridinyl)methyl]urea |
| SMILES | O=C(NCc1ccnc(-c2cccs2)c1)NC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H21N3OS/c28-24(26-17-18-13-14-25-21(16-18)22-12-7-15-29-22)27-23(19-8-3-1-4-9-19)20-10-5-2-6-11-20/h1-16,23H,17H2,(H2,26,27,28) |
| InChIKey | MHRNAWVKGLTGMT-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |